|
CAS#: 22048-16-4 Product: 3-Ethyl-2-Hydroxy-6-(3-Methylbutoxy)-4(1H)-Quinolinone No suppilers available for the product. |
| Name | 3-Ethyl-2-Hydroxy-6-(3-Methylbutoxy)-4(1H)-Quinolinone |
|---|---|
| Synonyms | 3-Ethyl-6-(isopentyloxy)-2,4-quinolinediol; 3-Ethyl-6-(isopentyloxy)-2,4-quinolinediol #; Carbostyril, 3-ethyl-4-hydroxy-6-(isopentyloxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34 |
| CAS Registry Number | 22048-16-4 |
| SMILES | O=C\2c1c(ccc(OCCC(C)C)c1)NC(/O)=C/2CC |
| InChI | 1S/C16H21NO3/c1-4-12-15(18)13-9-11(20-8-7-10(2)3)5-6-14(13)17-16(12)19/h5-6,9-10H,4,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | RAKLCVZEXLAVRH-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.525°C at 760 mmHg (Cal.) |
| Flash point | 205.707°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-2-Hydroxy-6-(3-Methylbutoxy)-4(1H)-Quinolinone |