Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Pentaphene |
|---|---|
| Synonyms | Pentapheno; Chebi:33147; 2,3:6,7-Dibenzphenanthrene |
| Molecular Structure |  |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 222-93-5 |
| EINECS | 205-927-6 |
| SMILES | C1=C4C(=C2C(=C1)C=C3C(=C2)C=CC=C3)C=C5C(=C4)C=CC=C5 |
| InChI | 1S/C22H14/c1-3-7-17-13-21-19(11-15(17)5-1)9-10-20-12-16-6-2-4-8-18(16)14-22(20)21/h1-14H |
| InChIKey | JQQSUOJIMKJQHS-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.7±17.0°C at 760 mmHg (Cal.) |
| Flash point | 264.5±15.1°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pentaphene |