Online Database of Chemicals from Around the World
|
CAS#: 22707-35-3 Product: Decyl Hexyl Adipate No suppilers available for the product. |
| Name | Decyl Hexyl Adipate |
|---|---|
| Synonyms | Hexanedioic Acid Decyl Ester Hexyl Ester; Adipic Acid Decyl Ester Hexyl Ester; Decyl Hexyl Adipate |
| Molecular Structure |  |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 |
| CAS Registry Number | 22707-35-3 |
| EINECS | 245-165-1 |
| SMILES | C(OC(=O)CCCCC(=O)OCCCCCC)CCCCCCCCC |
| InChI | 1S/C22H42O4/c1-3-5-7-9-10-11-12-16-20-26-22(24)18-14-13-17-21(23)25-19-15-8-6-4-2/h3-20H2,1-2H3 |
| InChIKey | QKZWHBZWJOJJHF-UHFFFAOYSA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.177°C at 760 mmHg (Cal.) |
| Flash point | 178.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decyl Hexyl Adipate |