Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (2R)-6-Iodo-2-Chromanecarboxylic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H9IO3 |
| Molecular Weight | 304.08 |
| CAS Registry Number | 227960-58-9 |
| SMILES | Ic2ccc1O[C@@H](C(=O)O)CCc1c2 |
| InChI | 1S/C10H9IO3/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13/h2,4-5,9H,1,3H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | KUUOJGIUGRFQCR-SECBINFHSA-N |
| Density | 1.881g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.62°C at 760 mmHg (Cal.) |
| Flash point | 211.812°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-6-Iodo-2-Chromanecarboxylic Acid |