|
CAS#: 24697-35-6 Product: 2,2,6,6-Tetramethyl-4-Methylene-3,5-Dioxa-2,6-Disilaheptane No suppilers available for the product. |
| Name | 2,2,6,6-Tetramethyl-4-Methylene-3,5-Dioxa-2,6-Disilaheptane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H20O2Si2 |
| Molecular Weight | 204.41 |
| CAS Registry Number | 24697-35-6 |
| SMILES | O(/C(O[Si](C)(C)C)=C)[Si](C)(C)C |
| InChI | 1S/C8H20O2Si2/c1-8(9-11(2,3)4)10-12(5,6)7/h1H2,2-7H3 |
| InChIKey | QTLOQPVMBORRRD-UHFFFAOYSA-N |
| Density | 0.853g/cm3 (Cal.) |
|---|---|
| Boiling point | 177.542°C at 760 mmHg (Cal.) |
| Flash point | 49.451°C (Cal.) |
| Refractive index | 1.412 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,6,6-Tetramethyl-4-Methylene-3,5-Dioxa-2,6-Disilaheptane |