|
CAS#: 24787-73-3 Product: L-Isoleucyl-L-Alanine No suppilers available for the product. |
| Name | L-Isoleucyl-L-Alanine |
|---|---|
| Synonyms | (2S,3S)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 24787-73-3 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](C)C(=O)O)N |
| InChI | 1S/C9H18N2O3/c1-4-5(2)7(10)8(12)11-6(3)9(13)14/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t5-,6-,7-/m0/s1 |
| InChIKey | RCFDOSNHHZGBOY-ACZMJKKPSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 201.6±24.6°C (Cal.) |
| Refractive index | 1.486 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Isoleucyl-L-Alanine |