Online Database of Chemicals from Around the World
|
CAS#: 2532-50-5 Product: Bis(trichloromethyl) trisulfide No suppilers available for the product. |
| Name | Bis(trichloromethyl) trisulfide |
|---|---|
| Synonyms | Trichloro-(Trichloromethylthio)Disulfanylmethane; Trichloro-(Trichloromethylthio)Disulfanyl-Methane; Brn 1765210 |
| Molecular Structure |  |
| Molecular Formula | C2Cl6S3 |
| Molecular Weight | 332.92 |
| CAS Registry Number | 2532-50-5 |
| SMILES | ClC(SSSC(Cl)(Cl)Cl)(Cl)Cl |
| InChI | 1S/C2Cl6S3/c3-1(4,5)9-11-10-2(6,7)8 |
| InChIKey | HEWWCALXHMTHHM-UHFFFAOYSA-N |
| Density | 1.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 223.931°C at 760 mmHg (Cal.) |
| Flash point | 90.732°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(trichloromethyl) trisulfide |