Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Methyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-D-Homoserinate |
|---|---|
| Synonyms | (R)-methyl 2-(tert-butoxycarbonylamino)-4-hydroxybutanoate |
| Molecular Structure | ![CAS#: 258351-86-9， Methyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-D-Homoserinate](/moreStructures/258351-86-9.gif) |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 |
| CAS Registry Number | 258351-86-9 |
| SMILES | O=C(OC(C)(C)C)N[C@@H](C(=O)OC)CCO |
| InChI | 1S/C10H19NO5/c1-10(2,3)16-9(14)11-7(5-6-12)8(13)15-4/h7,12H,5-6H2,1-4H3,(H,11,14)/t7-/m1/s1 |
| InChIKey | IWNVPOPPBRMFNG-SSDOTTSWSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.616°C at 760 mmHg (Cal.) |
| Flash point | 174.314°C (Cal.) |
| Refractive index | 1.462 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-D-Homoserinate |