|
CAS#: 25862-12-8 Product: 1,1'-Seleninylbis(4-Methylbenzene) No suppilers available for the product. |
| Name | 1,1'-Seleninylbis(4-Methylbenzene) |
|---|---|
| Synonyms | 1-Methyl-4-[(4-methylphenyl)seleninyl]benzene #; 4,4'-Dimethyldiphenyl selenoxide; Benzene, 1,1'-seleninylbis*4-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14OSe |
| Molecular Weight | 277.22 |
| CAS Registry Number | 25862-12-8 |
| SMILES | O=[Se](c1ccc(cc1)C)c2ccc(cc2)C |
| InChI | 1S/C14H14OSe/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | SSHNCKVJNHOUCT-UHFFFAOYSA-N |
| Boiling point | 241.204°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 99.677°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Seleninylbis(4-Methylbenzene) |