|
CAS#: 25948-40-7 Product: Trichloromethyl-Silane Polymer With Trichlorophenylsilane No suppilers available for the product. |
| Name | Trichloromethyl-Silane Polymer With Trichlorophenylsilane |
|---|---|
| Synonyms | Trichloro-Methyl-Silane; Trichloro-Phenyl-Silane; Silane, Trichloromethyl-, Polymer With Trichlorophenylsilane |
| Molecular Formula | C7H8Cl6Si2 |
| Molecular Weight | 361.03 |
| CAS Registry Number | 25948-40-7 |
| SMILES | [Si](C)(Cl)(Cl)Cl.C1=CC=CC=C1[Si](Cl)(Cl)Cl |
| InChI | 1S/C6H5Cl3Si.CH3Cl3Si/c7-10(8,9)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;1H3 |
| InChIKey | QTTUJQJIAPXSQQ-UHFFFAOYSA-N |
| Boiling point | 201°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87.5°C (Cal.) |
| Market Analysis Reports |