Online Database of Chemicals from Around the World
|
CAS#: 26471-56-7 Product: Dinitroaniline No suppilers available for the product. |
| Name | Dinitroaniline |
|---|---|
| Synonyms | (2,3-Dinitrophenyl)Amine; Ar,Ar-Dinitrobenzenamine; Benzenamine, Ar,Ar-Dinitro- |
| Molecular Structure |  |
| Molecular Formula | C6H5N3O4 |
| Molecular Weight | 183.12 |
| CAS Registry Number | 26471-56-7 |
| SMILES | C1=CC=C(N)C(=C1[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H5N3O4/c7-4-2-1-3-5(8(10)11)6(4)9(12)13/h1-3H,7H2 |
| InChIKey | CGNBQYFXGQHUQP-UHFFFAOYSA-N |
| Density | 1.587g/cm3 (Cal.) |
|---|---|
| Melting point | 122°C (Expl.) |
| Boiling point | 423.876°C at 760 mmHg (Cal.) |
| Flash point | 210.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinitroaniline |