Online Database of Chemicals from Around the World
|
CAS#: 3025-73-8 Product: 4-(3,4-Dimethylphenyl)Diazenyl-N,N-Dimethylaniline No suppilers available for the product. |
| Name | 4-(3,4-Dimethylphenyl)Diazenyl-N,N-Dimethylaniline |
|---|---|
| Synonyms | 4-(3,4-Dimethylphenyl)Azo-N,N-Dimethyl-Aniline; 4-(3,4-Dimethylphenyl)Azo-N,N-Dimethylaniline; [4-(3,4-Dimethylphenyl)Azophenyl]-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 |
| CAS Registry Number | 3025-73-8 |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C(=C2)C)C)N(C)C |
| InChI | 1S/C16H19N3/c1-12-5-6-15(11-13(12)2)18-17-14-7-9-16(10-8-14)19(3)4/h5-11H,1-4H3 |
| InChIKey | ILUWGGAOQJAFCM-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.856°C at 760 mmHg (Cal.) |
| Flash point | 199.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3,4-Dimethylphenyl)Diazenyl-N,N-Dimethylaniline |