Online Database of Chemicals from Around the World
|
CAS#: 3343-08-6 Product: 3-Methyl-2-Cholanthrenone No suppilers available for the product. |
| Name | 3-Methyl-2-Cholanthrenone |
|---|---|
| Synonyms | 3-Methylcholanthren-2-One; 3-Methylcholanthrene-2-One; Brn 2287429 |
| Molecular Structure |  |
| Molecular Formula | C21H14O |
| Molecular Weight | 282.34 |
| CAS Registry Number | 3343-08-6 |
| SMILES | C1=C(C)C3=C2C(=C1)C=C4C(=C2CC3=O)C=CC5=CC=CC=C45 |
| InChI | 1S/C21H14O/c1-12-6-7-14-10-17-15-5-3-2-4-13(15)8-9-16(17)18-11-19(22)20(12)21(14)18/h2-10H,11H2,1H3 |
| InChIKey | WZVWVFJAIXIJNQ-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.041°C at 760 mmHg (Cal.) |
| Flash point | 245.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-Cholanthrenone |