Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1H-Pyrazole-4,5-Dicarbonyl Dichloride |
|---|---|
| Synonyms | 1H-pyrazole-3,4-dicarbonyl dichloride |
| Molecular Structure |  |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.99 |
| CAS Registry Number | 35344-96-8 |
| SMILES | c1c(c([nH]n1)C(=O)Cl)C(=O)Cl |
| InChI | 1S/C5H2Cl2N2O2/c6-4(10)2-1-8-9-3(2)5(7)11/h1H,(H,8,9) |
| InChIKey | COEFVLAKIGYGHD-UHFFFAOYSA-N |
| Density | 1.696g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.29°C at 760 mmHg (Cal.) |
| Flash point | 183.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Pyrazole-4,5-Dicarbonyl Dichloride |