| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N,N'-Bis(2-hydroxybenzyl)ethylenediamine-N,N'-diacetic acid |
|---|---|
| Synonyms | 2-[2-[Carboxymethyl-(2-Hydroxybenzyl)Amino]Ethyl-(2-Hydroxybenzyl)Amino]Acetic Acid; 2-[2-[Carboxymethyl-[(2-Hydroxyphenyl)Methyl]Amino]Ethyl-[(2-Hydroxyphenyl)Methyl]Amino]Ethanoic Acid; Brn 3040730 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 |
| CAS Registry Number | 35998-29-9 |
| SMILES | C1=C(C(=CC=C1)CN(CCN(CC2=CC=CC=C2O)CC(=O)O)CC(=O)O)O |
| InChI | 1S/C20H24N2O6/c23-17-7-3-1-5-15(17)11-21(13-19(25)26)9-10-22(14-20(27)28)12-16-6-2-4-8-18(16)24/h1-8,23-24H,9-14H2,(H,25,26)(H,27,28) |
| InChIKey | GRUVVLWKPGIYEG-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.705°C at 760 mmHg (Cal.) |
| Flash point | 325.562°C (Cal.) |
| (1) | Santiago Herrero and Miguel A. Usón. Stereochemical nomenclature for octahedral coordination compounds containing polydentate ligands: a comprehensive proposal, Dalton Trans., 2008, 4993. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(2-hydroxybenzyl)ethylenediamine-N,N'-diacetic acid |