|
CAS#: 362043-85-4 Product: (4-Aminophenyl)(2-Fluorophenyl)Methanone No suppilers available for the product. |
| Name | (4-Aminophenyl)(2-Fluorophenyl)Methanone |
|---|---|
| Synonyms | (4-aminophenyl)-(2-fluorophenyl)methanone; 2-FLUORO-4-AMINOBENZOPHENONE; TL8002674 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.22 |
| CAS Registry Number | 362043-85-4 |
| SMILES | O=C(c1ccc(N)cc1)c2ccccc2F |
| InChI | 1S/C13H10FNO/c14-12-4-2-1-3-11(12)13(16)9-5-7-10(15)8-6-9/h1-8H,15H2 |
| InChIKey | FRGXRXKVVAHXBO-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.866°C at 760 mmHg (Cal.) |
| Flash point | 196.842°C (Cal.) |
| Refractive index | 1.609 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Aminophenyl)(2-Fluorophenyl)Methanone |