Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Nitro-2-Pyridinamine 1-Oxide |
|---|---|
| Synonyms | 2-amino-3-nitropyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 |
| CAS Registry Number | 385377-29-7 |
| SMILES | c1cc(c([n+](c1)[O-])N)[N+](=O)[O-] |
| InChI | 1S/C5H5N3O3/c6-5-4(8(10)11)2-1-3-7(5)9/h1-3H,6H2 |
| InChIKey | KLRNAOQFJWBSJN-UHFFFAOYSA-N |
| Density | 1.639g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.469°C at 760 mmHg (Cal.) |
| Flash point | 258.289°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2-Pyridinamine 1-Oxide |