Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4,7-Dimethylquinoline |
|---|---|
| Synonyms | Quinoline, 4,7-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.21 |
| CAS Registry Number | 40941-54-6 |
| EINECS | 255-148-0 |
| SMILES | C1=CC(=CC2=C1C(=CC=N2)C)C |
| InChI | 1S/C11H11N/c1-8-3-4-10-9(2)5-6-12-11(10)7-8/h3-7H,1-2H3 |
| InChIKey | LOMBYWOEYMBBGZ-UHFFFAOYSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.999°C at 760 mmHg (Cal.) |
| Flash point | 115.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dimethylquinoline |