Online Database of Chemicals from Around the World
|
CAS#: 41036-40-2 Product: N-Acetylphenylalanylglycinal No suppilers available for the product. |
| Name | N-Acetylphenylalanylglycinal |
|---|---|
| Synonyms | (2S)-2-Acetamido-N-(2-Oxoethyl)-3-Phenyl-Propanamide; (2S)-2-Acetamido-N-(2-Ketoethyl)-3-Phenyl-Propionamide; N-Acetyl-L-Phenylalanylaminoacetaldehyde |
| Molecular Structure |  |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 41036-40-2 |
| SMILES | [C@@H](C(=O)NCC=O)(CC1=CC=CC=C1)NC(=O)C |
| InChI | 1S/C13H16N2O3/c1-10(17)15-12(13(18)14-7-8-16)9-11-5-3-2-4-6-11/h2-6,8,12H,7,9H2,1H3,(H,14,18)(H,15,17)/t12-/m0/s1 |
| InChIKey | JOJRTULPKHKGCQ-LBPRGKRZSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.802°C at 760 mmHg (Cal.) |
| Flash point | 234.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetylphenylalanylglycinal |