Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Indoleglycerol Phosphate |
|---|---|
| Synonyms | 1-(Indol-3-Yl)Glycerol 3-Phosphate; 2,3-Dihydroxy-3-(1H-Indol-3-Yl)Propyl Dihydrogen Phosphate; Chebi:18299 |
| Molecular Structure |  |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 |
| CAS Registry Number | 4220-97-7 |
| SMILES | C2=C(C(C(CO[P](O)(O)=O)O)O)C1=C(C=CC=C1)[NH]2 |
| InChI | 1S/C11H14NO6P/c13-10(6-18-19(15,16)17)11(14)8-5-12-9-4-2-1-3-7(8)9/h1-5,10-14H,6H2,(H2,15,16,17) |
| InChIKey | NQEQTYPJSIEPHW-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 657.271°C at 760 mmHg (Cal.) |
| Flash point | 351.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indoleglycerol Phosphate |