Online Database of Chemicals from Around the World
|
CAS#: 425-11-6 Product: 1-Chloro-1,2,2-Trifluoro-1,2-Dinitroethane No suppilers available for the product. |
| Name | 1-Chloro-1,2,2-Trifluoro-1,2-Dinitroethane |
|---|---|
| Synonyms | 1-Chloro-1,2,2-Trifluoro-1,2-Dinitro-Ethane; 1-Chloro-1,2-Dinitro-1,2,2-Trifluoroethane; 4-01-00-00175 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C2ClF3N2O4 |
| Molecular Weight | 208.48 |
| CAS Registry Number | 425-11-6 |
| SMILES | O=[N+]([O-])C(Cl)(F)C(F)(F)[N+]([O-])=O |
| InChI | 1S/C2ClF3N2O4/c3-1(4,7(9)10)2(5,6)8(11)12 |
| InChIKey | FFFYUJXEAAHXMA-UHFFFAOYSA-N |
| Density | 1.814g/cm3 (Cal.) |
|---|---|
| Boiling point | 90.047°C at 760 mmHg (Cal.) |
| Flash point | 8.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-1,2,2-Trifluoro-1,2-Dinitroethane |