| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | N-Acetyl-5-Methoxy-DL-Tryptophan Monohydrate |
| Synonyms | (2S)-2-Acetamido-3-(5-Methoxy-1H-Indol-3-Yl)Propionic Acid; N-Acetyl-5-Methoxytryptophan; Tryptophan, N-Acetyl-5-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 43167-40-4 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CC1=C[NH]C2=CC=C(C=C12)OC |
| InChI | 1S/C14H16N2O4/c1-8(17)16-13(14(18)19)5-9-7-15-12-4-3-10(20-2)6-11(9)12/h3-4,6-7,13,15H,5H2,1-2H3,(H,16,17)(H,18,19)/t13-/m0/s1 |
| InChIKey | IJODSTPSSWJSBC-ZDUSSCGKSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.817°C at 760 mmHg (Cal.) |
| Flash point | 322.001°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-5-Methoxy-DL-Tryptophan Monohydrate |