Online Database of Chemicals from Around the World
|
CAS#: 4433-11-8 Product: 3,4-Dimethylbiphenyl No suppilers available for the product. |
| Name | 3,4-Dimethylbiphenyl |
|---|---|
| Synonyms | 1,2-Dimethyl-4-Phenyl-Benzene; 1,1'-Biphenyl, 3,4-Dimethyl-; 3,4-Dimethylbiphenyl |
| Molecular Structure |  |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 4433-11-8 |
| SMILES | C1=CC(=CC=C1)C2=CC=C(C(=C2)C)C |
| InChI | 1S/C14H14/c1-11-8-9-14(10-12(11)2)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | CKENDVLIAVMNDW-UHFFFAOYSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.999°C at 760 mmHg (Cal.) |
| Flash point | 128.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethylbiphenyl |