|
CAS#: 4712-12-3 Product: 4'-Methylchrysoeriol No suppilers available for the product. |
| Name | 4'-Methylchrysoeriol |
|---|---|
| Synonyms | 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-Chromen-4-One; 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-4-Chromenone; 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 |
| CAS Registry Number | 4712-12-3 |
| SMILES | C1=C(O)C=C(C2=C1OC(=CC2=O)C3=CC(=C(OC)C=C3)OC)O |
| InChI | 1S/C17H14O6/c1-21-13-4-3-9(5-15(13)22-2)14-8-12(20)17-11(19)6-10(18)7-16(17)23-14/h3-8,18-19H,1-2H3 |
| InChIKey | AOLOMULCAJQEIG-UHFFFAOYSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.309°C at 760 mmHg (Cal.) |
| Flash point | 201.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Methylchrysoeriol |