Online Database of Chemicals from Around the World
|
CAS#: 49644-04-4 Product: Androstane-3,6,17-Triol No suppilers available for the product. |
| Name | Androstane-3,6,17-Triol |
|---|---|
| Synonyms | 3Beta,6Alpha,17Beta-Trihydroxy-5Alpha-Androstane; 5Alpha-Androstane-3Beta,6Alpha,17Beta-Triol; 6Alpha-Triol |
| Molecular Structure |  |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 |
| CAS Registry Number | 49644-04-4 |
| SMILES | [C@H]13[C@@H]([C@@]2([C@@H]([C@@H](O)C1)C[C@@H](O)CC2)C)CC[C@]4([C@H]3CC[C@@H]4O)C |
| InChI | 1S/C19H32O3/c1-18-7-5-11(20)9-15(18)16(21)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h11-17,20-22H,3-10H2,1-2H3/t11-,12-,13-,14-,15+,16-,17-,18+,19-/m0/s1 |
| InChIKey | OFAZPSYXUKIJIK-JGRZZSDMSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.14°C at 760 mmHg (Cal.) |
| Flash point | 207.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Androstane-3,6,17-Triol |