Online Database of Chemicals from Around the World
|
CAS#: 49838-65-5 Product: Hexahydro-1,3-Dinitro-5-Nitroso-1H-1,3,5-Triazepine No suppilers available for the product. |
| Name | Hexahydro-1,3-Dinitro-5-Nitroso-1H-1,3,5-Triazepine |
|---|---|
| Synonyms | 1,3-Dinitro-5-Nitrosohexahydro-1H-1,3,5-Triazepine; 1H-1,3-5-Triazepine, Hexahydro-1,3-Dinitro-5-Nitroso- |
| Molecular Structure |  |
| Molecular Formula | C4H8N6O5 |
| Molecular Weight | 220.14 |
| CAS Registry Number | 49838-65-5 |
| SMILES | O=[N+]([O-])N1CN([N+]([O-])=O)CCN(N=O)C1 |
| InChI | 1S/C4H8N6O5/c11-5-6-1-2-7(9(12)13)4-8(3-6)10(14)15/h1-4H2 |
| InChIKey | PHSFGFFIQNTJJJ-UHFFFAOYSA-N |
| Density | 1.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 668.826°C at 760 mmHg (Cal.) |
| Flash point | 358.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexahydro-1,3-Dinitro-5-Nitroso-1H-1,3,5-Triazepine |