|
CAS#: 515142-45-7 Product: 3-Amino-5-(4-Chlorophenyl)-2-Thiophenecarboxamide No suppilers available for the product. |
| Name | 3-Amino-5-(4-Chlorophenyl)-2-Thiophenecarboxamide |
|---|---|
| Synonyms | 2-THIOPHENECARBOXAMIDE,3-AMINO-5-(4-CHLOROPHENYL)-; MFCD00179345; ZINC02556119 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.72 |
| CAS Registry Number | 515142-45-7 |
| SMILES | C1=CC(=CC=C1C2=CC(=C(S2)C(=O)N)N)Cl |
| InChI | 1S/C11H9ClN2OS/c12-7-3-1-6(2-4-7)9-5-8(13)10(16-9)11(14)15/h1-5H,13H2,(H2,14,15) |
| InChIKey | MQYJPACEBWKWEH-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 226.2±28.7°C (Cal.) |
| Refractive index | 1.685 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-5-(4-Chlorophenyl)-2-Thiophenecarboxamide |