| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-[(3R)-1-Azabicyclo[2.2.2]Oct-3-Yl]-2,3-Dihydro-1,4-Benzodioxine-6-Carboxamide (2E)-2-Butenedioate (1:1) |
|---|---|
| Synonyms | [527680-56-4]; N-(3R)-1- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.41 |
| CAS Registry Number | 527680-56-4 |
| SMILES | C1CN2CCC1[C@H](C2)NC(=O)C3=CC4=C(C=C3)OCCO4.C(=C/C(=O)O)\C(=O)O |
| InChI | 1S/C16H20N2O3.C4H4O4/c19-16(17-13-10-18-5-3-11(13)4-6-18)12-1-2-14-15(9-12)21-8-7-20-14;5-3(6)1-2-4(7)8/h1-2,9,11,13H,3-8,10H2,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-;/m0./s1 |
| InChIKey | QYQZUGYJVHHHEE-QDSMGTAFSA-N |
| Refractive index | (Cal.) |
|---|---|
| solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for N-[(3R)-1-Azabicyclo[2.2.2]Oct-3-Yl]-2,3-Dihydro-1,4-Benzodioxine-6-Carboxamide (2E)-2-Butenedioate (1:1) |