Online Database of Chemicals from Around the World
|
CAS#: 5386-28-7 Product: Fluoranthene-2,3-Quinone No suppilers available for the product. |
| Name | Fluoranthene-2,3-Quinone |
|---|---|
| Synonyms | Fluoranthene-2,3-Quinone; 2,3-Fluoranthenedione; Brn 2372042 |
| Molecular Structure |  |
| Molecular Formula | C16H8O2 |
| Molecular Weight | 232.24 |
| CAS Registry Number | 5386-28-7 |
| SMILES | C4=C2C1=C(C(=O)C(=O)C=C1C3=CC=CC=C23)C=C4 |
| InChI | 1S/C16H8O2/c17-14-8-13-10-5-2-1-4-9(10)11-6-3-7-12(15(11)13)16(14)18/h1-8H |
| InChIKey | BGTNPCLOWLFRRR-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.197°C at 760 mmHg (Cal.) |
| Flash point | 190.617°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluoranthene-2,3-Quinone |