Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (440) 337-1200 | |||
|
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | Alizarin Cyanine 2R |
|---|---|
| Synonyms | 1,2,4,5,8-Pentahydroxy-9,10-Anthraquinone; 9,10-Anthracenedione, 1,2,4,5,8-Pentahydroxy-; Alizarin Cyanin 2R |
| Molecular Structure |  |
| Molecular Formula | C14H8O7 |
| Molecular Weight | 288.21 |
| CAS Registry Number | 5413-65-0 |
| SMILES | C3=C(C2=C(C(C1=C(C=CC(=C1C2=O)O)O)=O)C(=C3O)O)O |
| InChI | 1S/C14H8O7/c15-4-1-2-5(16)9-8(4)13(20)10-6(17)3-7(18)12(19)11(10)14(9)21/h1-3,15-19H |
| InChIKey | LLDSAQJCCUZHBA-UHFFFAOYSA-N |
| Density | 1.906g/cm3 (Cal.) |
|---|---|
| Boiling point | 616.003°C at 760 mmHg (Cal.) |
| Flash point | 340.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alizarin Cyanine 2R |