Online Database of Chemicals from Around the World
|
CAS#: 54810-82-1 Product: 3,5-Dimethylbiphenyl-4-Amine No suppilers available for the product. |
| Name | 3,5-Dimethylbiphenyl-4-Amine |
|---|---|
| Synonyms | 2,6-Dimethyl-4-Phenyl-Aniline; (2,6-Dimethyl-4-Phenyl-Phenyl)Amine; (1,1'-Biphenyl)-4-Amine, 3,5-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 54810-82-1 |
| SMILES | C1=C(C=C(C)C(=C1C)N)C2=CC=CC=C2 |
| InChI | 1S/C14H15N/c1-10-8-13(9-11(2)14(10)15)12-6-4-3-5-7-12/h3-9H,15H2,1-2H3 |
| InChIKey | WTPHINPQMXHNMI-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.247°C at 760 mmHg (Cal.) |
| Flash point | 150.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethylbiphenyl-4-Amine |