Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Methyl 2-Amino-1-Cyclohexene-1-Carboxylate |
|---|---|
| Synonyms | (1R)-2-Imino-1-Cyclohexanecarboxylic Acid Methyl Ester; (1R)-2-Iminocyclohexane-1-Carboxylic Acid Methyl Ester; Zinc04262219 |
| Molecular Structure |  |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 |
| CAS Registry Number | 56661-88-2 |
| SMILES | [C@@H]1(C(=N)CCCC1)C(OC)=O |
| InChI | 1S/C8H13NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h6,9H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | FDEZKFZZXQOWMM-ZCFIWIBFSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.887°C at 760 mmHg (Cal.) |
| Flash point | 83.794°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Amino-1-Cyclohexene-1-Carboxylate |