| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glycine derivatives |
|---|---|
| Name | Cbz-Gly Hydrazide |
| Synonyms | Phenylmethyl N-(2-Hydrazino-2-Oxo-Ethyl)Carbamate; N-(2-Hydrazino-2-Oxoethyl)Carbamic Acid Phenylmethyl Ester; N-(2-Hydrazino-2-Keto-Ethyl)Carbamic Acid Benzyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 5680-83-1 |
| EINECS | 227-141-2 |
| SMILES | C1=CC=CC=C1COC(NCC(NN)=O)=O |
| InChI | 1S/C10H13N3O3/c11-13-9(14)6-12-10(15)16-7-8-4-2-1-3-5-8/h1-5H,6-7,11H2,(H,12,15)(H,13,14) |
| InChIKey | FBXJOIKPPWLCJU-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.623°C at 760 mmHg (Cal.) |
| Flash point | 251.125°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Cbz-Gly Hydrazide |