Online Database of Chemicals from Around the World
|
CAS#: 5796-93-0 Product: Perylene-3,10-Dione No suppilers available for the product. |
| Name | Perylene-3,10-Dione |
|---|---|
| Synonyms | Perylene-3,10-Quinone; Zinc01686586; 3,10-Perylenequinone |
| Molecular Structure |  |
| Molecular Formula | C20H10O2 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 5796-93-0 |
| SMILES | C1=CC=C4C2=C1C(=O)C=CC2=C3C5=C(C(C=C3)=O)C=CC=C45 |
| InChI | 1S/C20H10O2/c21-17-9-7-13-14-8-10-18(22)16-6-2-4-12(20(14)16)11-3-1-5-15(17)19(11)13/h1-10H |
| InChIKey | FUTARTAINOHELR-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.137°C at 760 mmHg (Cal.) |
| Flash point | 206.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perylene-3,10-Dione |