Online Database of Chemicals from Around the World
| Name | 4-Bromobenzenesulfonic Acid Methyl Ester |
|---|---|
| Synonyms | 4-Bromobenzenesulfonic Acid Methyl Ester; Benzenesulfonic Acid, 4-Bromo-, Methyl Ester; Benzenesulfonic Acid, P-Bromo-, Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C7H7BrO3S |
| Molecular Weight | 251.09 |
| CAS Registry Number | 6213-85-0 |
| SMILES | C1=CC(=CC=C1[S](OC)(=O)=O)Br |
| InChI | 1S/C7H7BrO3S/c1-11-12(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | PYDQNCFCJQEDFL-UHFFFAOYSA-N |
| Density | 1.633g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.498°C at 760 mmHg (Cal.) |
| Flash point | 145.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromobenzenesulfonic Acid Methyl Ester |
