Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Cyclopentyl-3-Azabicyclo[3.1.0]Hexane-1-Carboxylic Acid |
|---|---|
| Synonyms | 3-cyclopentyl-3-azabicyclo[3.1.0]hexane-1-carboxylic acid |
| Molecular Structure | ![CAS#: 63618-05-3， 3-Cyclopentyl-3-Azabicyclo[3.1.0]Hexane-1-Carboxylic Acid](/moreStructures/63618-05-3.gif) |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 |
| CAS Registry Number | 63618-05-3 |
| SMILES | C1CCC(C1)N2CC3CC3(C2)C(=O)O |
| InChI | 1S/C11H17NO2/c13-10(14)11-5-8(11)6-12(7-11)9-3-1-2-4-9/h8-9H,1-7H2,(H,13,14) |
| InChIKey | LRZMTQXRQCBWMH-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.358°C at 760 mmHg (Cal.) |
| Flash point | 148.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclopentyl-3-Azabicyclo[3.1.0]Hexane-1-Carboxylic Acid |