Online Database of Chemicals from Around the World
|
CAS#: 65847-03-2 Product: Tecleaverdoornine No suppilers available for the product. |
| Name | Tecleaverdoornine |
|---|---|
| Synonyms | Tecleaverdoornine; Nsc348951; Tecleav |
| Molecular Structure |  |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 |
| CAS Registry Number | 65847-03-2 |
| SMILES | C2=COC3=NC1=C(C4=C(C(=C1C(=C23)OC)CC=C(C)C)OCO4)O |
| InChI | 1S/C18H17NO5/c1-9(2)4-5-10-12-13(14(20)17-16(10)23-8-24-17)19-18-11(6-7-22-18)15(12)21-3/h4,6-7,20H,5,8H2,1-3H3 |
| InChIKey | DVYGQAMJPXHFED-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.275°C at 760 mmHg (Cal.) |
| Flash point | 263.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tecleaverdoornine |