|
CAS#: 67700-30-5 Product: Furaprofen No suppilers available for the product. |
| Classification | API >> Antipyretic analgesics >> Non-steroidal anti-inflammatory drugs |
|---|---|
| Name | Furaprofen |
| Synonyms | 2-(3-Phenylbenzofuran-7-Yl)Propanoic Acid; 2-(3-Phenyl-7-Benzofuranyl)Propanoic Acid; 2-(3-Phenylbenzofuran-7-Yl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 67700-30-5 (37664-95-2) |
| EINECS | 266-919-6 |
| SMILES | C1=CC=C(C2=C1C(=CO2)C3=CC=CC=C3)C(C(O)=O)C |
| InChI | 1S/C17H14O3/c1-11(17(18)19)13-8-5-9-14-15(10-20-16(13)14)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) |
| InChIKey | ODZUWQAFWMLWCF-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.408°C at 760 mmHg (Cal.) |
| Flash point | 225.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Furaprofen |