Online Database of Chemicals from Around the World
|
CAS#: 67844-27-3 Product: (1S,2S,4R)-2-chloronorbornane No suppilers available for the product. |
| Name | (1S,2S,4R)-2-chloronorbornane |
|---|---|
| Synonyms | (±)-EXO-2-CHLORONORBORNANE |
| Molecular Structure |  |
| Molecular Formula | C7H11Cl |
| Molecular Weight | 130.62 |
| CAS Registry Number | 67844-27-3 |
| SMILES | Cl[C@H]2C[C@H]1C[C@@H]2CC1 |
| InChI | 1S/C7H11Cl/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | PJWBUKHIZPKRJF-VQVTYTSYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 159.175°C at 760 mmHg (Cal.) |
| Flash point | 44.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2S,4R)-2-chloronorbornane |