Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[4-Methoxy-3-(Methylamino)Phenyl]-Acetamide |
|---|---|
| Synonyms | N-(4-Methoxy-3-Methylamino-Phenyl)Acetamide; N-(4-Methoxy-3-Methylamino-Phenyl)Ethanamide; Acetamide, N-(4-Methoxy-3-(Methylamino)Phenyl)- |
| Molecular Structure | ![CAS#: 67940-01-6， N-[4-Methoxy-3-(Methylamino)Phenyl]-Acetamide](/moreStructures/67940-01-6.gif) |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 67940-01-6 |
| EINECS | 267-874-5 |
| SMILES | C1=C(OC)C(=CC(=C1)NC(=O)C)NC |
| InChI | 1S/C10H14N2O2/c1-7(13)12-8-4-5-10(14-3)9(6-8)11-2/h4-6,11H,1-3H3,(H,12,13) |
| InChIKey | KHWKGYUMZHRENM-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.454°C at 760 mmHg (Cal.) |
| Flash point | 186.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-Methoxy-3-(Methylamino)Phenyl]-Acetamide |