Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Bis(2,4,6-Tribromophenyl) Carbonate |
|---|---|
| Synonyms | Carbonic Acid Bis(2,4,6-Tribromophenyl) Ester; Phenol, 2,4,6-Tribromo-, Carbonate (2:1) |
| Molecular Structure |  |
| Molecular Formula | C13H4Br6O3 |
| Molecular Weight | 687.60 |
| CAS Registry Number | 67990-32-3 |
| EINECS | 268-053-4 |
| SMILES | C1=C(Br)C(=C(C=C1Br)Br)OC(=O)OC2=C(Br)C=C(C=C2Br)Br |
| InChI | 1S/C13H4Br6O3/c14-5-1-7(16)11(8(17)2-5)21-13(20)22-12-9(18)3-6(15)4-10(12)19/h1-4H |
| InChIKey | KYCZCJACRVPWFK-UHFFFAOYSA-N |
| Density | 2.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.45°C at 760 mmHg (Cal.) |
| Flash point | 284.283°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,4,6-Tribromophenyl) Carbonate |