|
CAS#: 681249-59-2 Product: 2-Methyl-2-propanyl 2-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[1,5-a]pyrazine-7(8H)-carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 2-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[1,5-a]pyrazine-7(8H)-carboxylate |
|---|---|
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 |
| CAS Registry Number | 681249-59-2 |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(nc(n2)C(F)(F)F)C1 |
| InChI | 1S/C11H15F3N4O2/c1-10(2,3)20-9(19)17-4-5-18-7(6-17)15-8(16-18)11(12,13)14/h4-6H2,1-3H3 |
| InChIKey | DMGHMNCRYGWVFF-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.945°C at 760 mmHg (Cal.) |
| Flash point | 169.675°C (Cal.) |
| Refractive index | 1.544 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 2-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[1,5-a]pyrazine-7(8H)-carboxylate |