Online Database of Chemicals from Around the World
|
CAS#: 68959-40-0 Product: 1,3,5-Trinitro-2,4,6-Tripropoxybenzene No suppilers available for the product. |
| Name | 1,3,5-Trinitro-2,4,6-Tripropoxybenzene |
|---|---|
| Synonyms | 1,3,5-Trinitro-2,4,6-Tripropoxy-Benzene; 1,3,5-Tripropoxy-2,4,6-Trinitrobenzene; Benzene, 1,3,5-Trinitro-2,4,6-Tripropoxy- |
| Molecular Structure |  |
| Molecular Formula | C15H21N3O9 |
| Molecular Weight | 387.35 |
| CAS Registry Number | 68959-40-0 |
| SMILES | C(OC1=C([N+]([O-])=O)C(=C(C(=C1[N+]([O-])=O)OCCC)[N+]([O-])=O)OCCC)CC |
| InChI | 1S/C15H21N3O9/c1-4-7-25-13-10(16(19)20)14(26-8-5-2)12(18(23)24)15(27-9-6-3)11(13)17(21)22/h4-9H2,1-3H3 |
| InChIKey | AJBWVJLJSBSNPC-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.026°C at 760 mmHg (Cal.) |
| Flash point | 229.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trinitro-2,4,6-Tripropoxybenzene |