Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-amino-4-[(dimethylamino)methyl]benzoate |
|---|---|
| Synonyms | methyl 2-amino-4-((dimethylamino)methyl)benzoate |
| Molecular Structure | ![CAS#: 697306-04-0， Methyl 2-amino-4-[(dimethylamino)methyl]benzoate](/moreStructures/697306-04-0.gif) |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 697306-04-0 |
| SMILES | CN(C)Cc1ccc(c(c1)N)C(=O)OC |
| InChI | 1S/C11H16N2O2/c1-13(2)7-8-4-5-9(10(12)6-8)11(14)15-3/h4-6H,7,12H2,1-3H3 |
| InChIKey | MVZGCPJKOQANMP-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.786°C at 760 mmHg (Cal.) |
| Flash point | 140.549°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-amino-4-[(dimethylamino)methyl]benzoate |