Online Database of Chemicals from Around the World
|
CAS#: 71173-56-3 Product: 7-(Ethylamino)-2-Benzopyrone No suppilers available for the product. |
| Name | 7-(Ethylamino)-2-Benzopyrone |
|---|---|
| Synonyms | 7-Ethylamino-2-Chromenone; 7-Ethylaminocoumarin; 2H-1-Benzopyran-2-One, 7-(Ethylamino)- |
| Molecular Structure |  |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 71173-56-3 |
| EINECS | 275-245-1 |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)NCC |
| InChI | 1S/C11H11NO2/c1-2-12-9-5-3-8-4-6-11(13)14-10(8)7-9/h3-7,12H,2H2,1H3 |
| InChIKey | LQDAIRJFZNQMNK-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.775°C at 760 mmHg (Cal.) |
| Flash point | 177.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(Ethylamino)-2-Benzopyrone |