Online Database of Chemicals from Around the World
| Name | 9-Amino-1,3-Dichloro-8-Methylphenazin-2-Ol |
|---|---|
| Synonyms | 9-Amino-1,3-Dichloro-8-Methylphenazin-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 |
| CAS Registry Number | 71463-53-1 |
| EINECS | 275-492-5 |
| SMILES | C1=CC(=C(N)C3=C1N=C2C(=C(Cl)C(=O)C(=C2)Cl)N3)C |
| InChI | 1S/C13H9Cl2N3O/c1-5-2-3-7-12(10(5)16)18-11-8(17-7)4-6(14)13(19)9(11)15/h2-4,18H,16H2,1H3 |
| InChIKey | ARKFZSCWHTVUQN-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.505°C at 760 mmHg (Cal.) |
| Flash point | 206.905°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Amino-1,3-Dichloro-8-Methylphenazin-2-Ol |
