|
CAS#: 71606-02-5 Product: (Z)-but-2-enedioate, 2-isopropenyloxyprop-1-ene No suppilers available for the product. |
| Name | (Z)-but-2-enedioate, 2-isopropenyloxyprop-1-ene |
|---|---|
| Synonyms | oxybis(methylethylene) maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 71606-02-5 |
| EINECS | 275-669-7 |
| SMILES | [O-]C(=O)/C=C\C([O-])=O.CC(=C)OC(C)=C |
| InChI | 1S/C6H10O.C4H4O4/c1-5(2)7-6(3)4;5-3(6)1-2-4(7)8/h1,3H2,2,4H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | PRJAAIKLMMDWFU-BTJKTKAUSA-L |
| Boiling point | 376.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-but-2-enedioate, 2-isopropenyloxyprop-1-ene |