Online Database of Chemicals from Around the World
|
CAS#: 7229-69-8 Product: 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-9,10-Anthracenedione No suppilers available for the product. |
| Name | 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-9,10-Anthracenedione |
|---|---|
| Synonyms | 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-Anthracene-9,10-Dione; 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-9,10-Anthraquinone; 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-9,10-Anthracenedione |
| Molecular Structure |  |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 |
| CAS Registry Number | 7229-69-8 |
| SMILES | C1=C3C(=C(O)C=C1C)C(=O)C2=C(O)C(=C(OC)C(=C2C3=O)O)O |
| InChI | 1S/C16H12O7/c1-5-3-6-8(7(17)4-5)12(19)10-9(11(6)18)14(21)16(23-2)15(22)13(10)20/h3-4,17,20-22H,1-2H3 |
| InChIKey | WZDHOIZUFUBGHK-UHFFFAOYSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.102°C at 760 mmHg (Cal.) |
| Flash point | 228.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,5-Tetrahydroxy-2-Methoxy-7-Methyl-9,10-Anthracenedione |