Online Database of Chemicals from Around the World
| Gelest, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (215) 547-1015 | |||
 |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | Dimethyl(diphenyl)germane |
|---|---|
| Synonyms | Dimethyl(diphenyl)german; dimethyl(diphenyl)germane; DIMETHYLDIPHENYLGERMANE |
| Molecular Structure |  |
| Molecular Formula | C14H16Ge |
| Molecular Weight | 256.92 |
| CAS Registry Number | 7301-42-0 |
| SMILES | C[Ge](C)(c1ccccc1)c2ccccc2 |
| InChI | 1S/C14H16Ge/c1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | QTOKZEXKYJMZND-UHFFFAOYSA-N |
| Boiling point | 292.556°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.076°C (Cal.) |
| Refractive index | 1.573 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl(diphenyl)germane |