Online Database of Chemicals from Around the World
|
CAS#: 77898-96-5 Product: 1,3-Dibromo-2-(2,3-Dibromopropoxy)-5-Methylbenzene No suppilers available for the product. |
| Name | 1,3-Dibromo-2-(2,3-Dibromopropoxy)-5-Methylbenzene |
|---|---|
| Synonyms | 1,3-Dibromo-2-(2,3-Dibromopropoxy)-5-Methyl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C10H10Br4O |
| Molecular Weight | 465.80 |
| CAS Registry Number | 77898-96-5 |
| EINECS | 278-788-2 |
| SMILES | C1=C(Br)C(=C(Br)C=C1C)OCC(Br)CBr |
| InChI | 1S/C10H10Br4O/c1-6-2-8(13)10(9(14)3-6)15-5-7(12)4-11/h2-3,7H,4-5H2,1H3 |
| InChIKey | XPMYXNJOFNBHOK-UHFFFAOYSA-N |
| Density | 2.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.04°C at 760 mmHg (Cal.) |
| Flash point | 175.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dibromo-2-(2,3-Dibromopropoxy)-5-Methylbenzene |